About 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane
3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane (PubChem CID 58624457) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane.
Analyze 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane?
The IUPAC name of 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane (CID 58624457) is 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane.
What is the SMILES notation for 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane?
The canonical SMILES for 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane is CC1CC2C(CC1C(C)(C)C)C2(C)C.
What is the InChIKey of 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane?
The InChIKey is HGOUSEWFGKKMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-9-7-11-12(14(11,5)6)8-10(9)13(2,3)4/h9-12H,7-8H2,1-6H3.
What are the key properties of 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane?
3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane has a molecular weight of 194.36 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4,7,7-trimethylbicyclo[4.1.0]heptane is sourced from PubChem (CID 58624457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).