C16H22O2S — CID 586248
(2,6,6-trimethylcyclohexen-1-yl)methylsulfonylbenzene (PubChem CID 586248) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is (2,6,6-trimethylcyclohexen-1-yl)methylsulfonylbenzene.
| Compound Name | (2,6,6-trimethylcyclohexen-1-yl)methylsulfonylbenzene |
|---|---|
| PubChem CID | 586248 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2,6,6-trimethylcyclohexen-1-yl)methylsulfonylbenzene |
| SMILES | CC1=C(CS(=O)(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H22O2S/c1-13-8-7-11-16(2,3)15(13)12-19(17,18)14-9-5-4-6-10-14/h4-6,9-10H,7-8,11-12H2,1-3H3 |
| InChIKey | WQRHISGXRFLGKQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|