C18H26N2O4S — CID 58624935
2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate (PubChem CID 58624935) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate.
| Compound Name | 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate |
|---|---|
| PubChem CID | 58624935 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-O-tert-butyl 8-O-ethyl 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1C1CN(C(=O)OC(C)(C)C)CC1CC2 |
| InChI | InChI=1S/C18H26N2O4S/c1-5-23-16(21)14-13-11-9-20(17(22)24-18(2,3)4)8-10(11)6-7-12(13)25-15(14)19/h10-11H,5-9,19H2,1-4H3 |
| InChIKey | ZFTSGUUXMNOQDT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|