C21H34O4 — CID 58624959
(6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyhenicosa-8,10,12,14-tetraen-2-one (PubChem CID 58624959) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyhenicosa-8,10,12,14-tetraen-2-one.
| Compound Name | (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyhenicosa-8,10,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 58624959 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (6S,7R,8E,10E,12Z,14E,16S)-6,7,16-trihydroxyhenicosa-8,10,12,14-tetraen-2-one |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(C)=O |
| InChI | InChI=1S/C21H34O4/c1-3-4-9-14-19(23)15-10-7-5-6-8-11-16-20(24)21(25)17-12-13-18(2)22/h5-8,10-11,15-16,19-21,23-25H,3-4,9,12-14,17H2,1-2H3/b7-5-,8-6+,15-10+,16-11+/t19-,20+,21-/m0/s1 |
| InChIKey | XBERHBXBJOMTAI-CGUOXZTOSA-N |
| XLogP | 3.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|