C30H48O10 — CID 58624979
2-[2-[2-(3-oxobutanoyloxy)ethoxy]ethoxy]ethyl 3,4-bis(2,2-dimethylpropanoyl)-2-(2-methylpropanoyl)cyclopentane-1-carboxylate (PubChem CID 58624979) has the molecular formula C30H48O10 and a molecular weight of 568.70 g/mol. Its IUPAC name is 2-[2-[2-(3-oxobutanoyloxy)ethoxy]ethoxy]ethyl 3,4-bis(2,2-dimethylpropanoyl)-2-(2-methylpropanoyl)cyclopentane-1-carboxylate.
| Compound Name | 2-[2-[2-(3-oxobutanoyloxy)ethoxy]ethoxy]ethyl 3,4-bis(2,2-dimethylpropanoyl)-2-(2-methylpropanoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58624979 |
| Molecular Formula | C30H48O10 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | 2-[2-[2-(3-oxobutanoyloxy)ethoxy]ethoxy]ethyl 3,4-bis(2,2-dimethylpropanoyl)-2-(2-methylpropanoyl)cyclopentane-1-carboxylate |
| SMILES | CC(=O)CC(=O)OCCOCCOCCOC(=O)C1CC(C(=O)C(C)(C)C)C(C(=O)C(C)(C)C)C1C(=O)C(C)C |
| InChI | InChI=1S/C30H48O10/c1-18(2)25(33)23-21(17-20(26(34)29(4,5)6)24(23)27(35)30(7,8)9)28(36)40-15-13-38-11-10-37-12-14-39-22(32)16-19(3)31/h18,20-21,23-24H,10-17H2,1-9H3 |
| InChIKey | INFRHTLSBGVQII-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|