C32H42N4O4 — CID 58625078
4-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 58625078) has the molecular formula C32H42N4O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is 4-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58625078 |
| Molecular Formula | C32H42N4O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 4-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)CC[C@@H](C1CCCCC1)N1Cc2cc(Oc3ccccc3)ccc2N=C1N)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C32H42N4O4/c1-35(25-14-12-23(13-15-25)31(38)39)30(37)19-18-29(22-8-4-2-5-9-22)36-21-24-20-27(16-17-28(24)34-32(36)33)40-26-10-6-3-7-11-26/h3,6-7,10-11,16-17,20,22-23,25,29H,2,4-5,8-9,12-15,18-19,21H2,1H3,(H2,33,34)(H,38,39)/t23?,25?,29-/m0/s1 |
| InChIKey | QZACRAOIECNKDH-VDNFTXHKSA-N |
| XLogP | 6.07 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |