C23H25Cl2F3NO4P — CID 58625300
3-[[2-chloro-5-[(5-chloro-2-adamantylidene)-(2,2,2-trifluoroethoxy)methyl]phenoxy]-methylphosphoryl]oxypropanenitrile (PubChem CID 58625300) has the molecular formula C23H25Cl2F3NO4P and a molecular weight of 538.33 g/mol. Its IUPAC name is 3-[[2-chloro-5-[(5-chloro-2-adamantylidene)-(2,2,2-trifluoroethoxy)methyl]phenoxy]-methylphosphoryl]oxypropanenitrile.
| Compound Name | 3-[[2-chloro-5-[(5-chloro-2-adamantylidene)-(2,2,2-trifluoroethoxy)methyl]phenoxy]-methylphosphoryl]oxypropanenitrile |
|---|---|
| PubChem CID | 58625300 |
| Molecular Formula | C23H25Cl2F3NO4P |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 3-[[2-chloro-5-[(5-chloro-2-adamantylidene)-(2,2,2-trifluoroethoxy)methyl]phenoxy]-methylphosphoryl]oxypropanenitrile |
| SMILES | CP(=O)(OCCC#N)Oc1cc(C(OCC(F)(F)F)=C2C3CC4CC2CC(Cl)(C4)C3)ccc1Cl |
| InChI | InChI=1S/C23H25Cl2F3NO4P/c1-34(30,32-6-2-5-29)33-19-9-15(3-4-18(19)24)21(31-13-23(26,27)28)20-16-7-14-8-17(20)12-22(25,10-14)11-16/h3-4,9,14,16-17H,2,6-8,10-13H2,1H3/b21-20- |
| InChIKey | BESCJBYJXFSUIK-MRCUWXFGSA-N |
| XLogP | 7.58 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|