C18H19F5N2O — CID 58625403
2-[2-[(dimethylamino)methyl]phenoxy]-5-(2,2,3,3,3-pentafluoropropyl)aniline (PubChem CID 58625403) has the molecular formula C18H19F5N2O and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]phenoxy]-5-(2,2,3,3,3-pentafluoropropyl)aniline.
| Compound Name | 2-[2-[(dimethylamino)methyl]phenoxy]-5-(2,2,3,3,3-pentafluoropropyl)aniline |
|---|---|
| PubChem CID | 58625403 |
| Molecular Formula | C18H19F5N2O |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]phenoxy]-5-(2,2,3,3,3-pentafluoropropyl)aniline |
| SMILES | CN(C)Cc1ccccc1Oc1ccc(CC(F)(F)C(F)(F)F)cc1N |
| InChI | InChI=1S/C18H19F5N2O/c1-25(2)11-13-5-3-4-6-15(13)26-16-8-7-12(9-14(16)24)10-17(19,20)18(21,22)23/h3-9H,10-11,24H2,1-2H3 |
| InChIKey | XFRJUDVVOFCYLY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|