C13H16F7NO6 — CID 58625651
2-[[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(2-fluoroethoxy)ethoxy]ethoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 58625651) has the molecular formula C13H16F7NO6 and a molecular weight of 415.26 g/mol. Its IUPAC name is 2-[[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(2-fluoroethoxy)ethoxy]ethoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(2-fluoroethoxy)ethoxy]ethoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58625651 |
| Molecular Formula | C13H16F7NO6 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(2-fluoroethoxy)ethoxy]ethoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(F)(F)OC(F)(F)C(F)(F)OCCF |
| InChI | InChI=1S/C13H16F7NO6/c1-8(2)9(22)24-6-4-21-10(23)25-7-11(15,16)27-13(19,20)12(17,18)26-5-3-14/h1,3-7H2,2H3,(H,21,23) |
| InChIKey | XPBUWLVMAXSTGS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|