About trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane
trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane (PubChem CID 58625761) has the molecular formula C14H38Si4
and a molecular weight of 318.80 g/mol. Its IUPAC name is trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane.
Molecular Properties
| Compound Name | trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane |
| PubChem CID | 58625761 |
| Molecular Formula | C14H38Si4 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane |
| SMILES | C[Si](C)(C)C(C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H38Si4/c1-15(2,3)13(16(4,5)6)14(17(7,8)9)18(10,11)12/h13-14H,1-12H3 |
| InChIKey | HLABIOCHGZSMBX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane?
The IUPAC name of trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane (CID 58625761) is trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane.
What is the SMILES notation for trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane?
The canonical SMILES for trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane is C[Si](C)(C)C(C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane?
The InChIKey is HLABIOCHGZSMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H38Si4/c1-15(2,3)13(16(4,5)6)14(17(7,8)9)18(10,11)12/h13-14H,1-12H3.
What are the key properties of trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane?
trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane has a molecular weight of 318.80 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1,2,2-tris(trimethylsilyl)ethyl]silane is sourced from PubChem (CID 58625761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).