C32H32F9N5OSi — CID 58625846
trimethyl-[2-[[5-[4-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-(3,4,5-trifluorophenyl)imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 58625846) has the molecular formula C32H32F9N5OSi and a molecular weight of 701.71 g/mol. Its IUPAC name is trimethyl-[2-[[5-[4-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-(3,4,5-trifluorophenyl)imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-[4-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-(3,4,5-trifluorophenyl)imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58625846 |
| Molecular Formula | C32H32F9N5OSi |
| Molecular Weight | 701.71 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | trimethyl-[2-[[5-[4-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-4-(3,4,5-trifluorophenyl)imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1c(N2CCN(c3ncccc3C(F)(F)F)CC2)nc(-c2cc(F)c(F)c(F)c2)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H32F9N5OSi/c1-48(2,3)16-15-47-19-46-28(20-6-8-22(9-7-20)31(36,37)38)27(21-17-24(33)26(35)25(34)18-21)43-30(46)45-13-11-44(12-14-45)29-23(32(39,40)41)5-4-10-42-29/h4-10,17-18H,11-16,19H2,1-3H3 |
| InChIKey | XTMYTILXBQGAES-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.71 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|