C22H22N2O6S — CID 58626316
2,3,4-trihydroxy-N-[3-[(3-propan-2-ylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 58626316) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-[3-[(3-propan-2-ylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2,3,4-trihydroxy-N-[3-[(3-propan-2-ylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58626316 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2,3,4-trihydroxy-N-[3-[(3-propan-2-ylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CC(C)c1cccc(NS(=O)(=O)c2cccc(NC(=O)c3ccc(O)c(O)c3O)c2)c1 |
| InChI | InChI=1S/C22H22N2O6S/c1-13(2)14-5-3-7-16(11-14)24-31(29,30)17-8-4-6-15(12-17)23-22(28)18-9-10-19(25)21(27)20(18)26/h3-13,24-27H,1-2H3,(H,23,28) |
| InChIKey | IUGFJQIDBCOABY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|