About 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol
4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol (PubChem CID 58626406) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol |
| PubChem CID | 58626406 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol |
| SMILES | CC(C)c1cc(Cc2cc(Cc3ccccc3)c(O)c(O)c2O)ccc1O |
| InChI | InChI=1S/C23H24O4/c1-14(2)19-12-16(8-9-20(19)24)11-18-13-17(21(25)23(27)22(18)26)10-15-6-4-3-5-7-15/h3-9,12-14,24-27H,10-11H2,1-2H3 |
| InChIKey | MAORTJQDBYJZRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol?
The IUPAC name of 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol (CID 58626406) is 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol.
What is the SMILES notation for 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol?
The canonical SMILES for 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol is CC(C)c1cc(Cc2cc(Cc3ccccc3)c(O)c(O)c2O)ccc1O.
What is the InChIKey of 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol?
The InChIKey is MAORTJQDBYJZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O4/c1-14(2)19-12-16(8-9-20(19)24)11-18-13-17(21(25)23(27)22(18)26)10-15-6-4-3-5-7-15/h3-9,12-14,24-27H,10-11H2,1-2H3.
What are the key properties of 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol?
4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol has a molecular weight of 364.44 g/mol, XLogP of 4.81, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-6-[(4-hydroxy-3-propan-2-ylphenyl)methyl]benzene-1,2,3-triol is sourced from PubChem (CID 58626406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).