C39H37N3O9S2 — CID 58626430
2-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxybenzoyl]-N-[2-(4-phenoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 58626430) has the molecular formula C39H37N3O9S2 and a molecular weight of 755.87 g/mol. Its IUPAC name is 2-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxybenzoyl]-N-[2-(4-phenoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxybenzoyl]-N-[2-(4-phenoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 58626430 |
| Molecular Formula | C39H37N3O9S2 |
| Molecular Weight | 755.87 g/mol |
| Exact Mass | 755.20 |
| IUPAC Name | 2-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxybenzoyl]-N-[2-(4-phenoxyphenyl)ethyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCc3ccccc3C2)c(O)c(O)c1O)N1CCc2ccc(S(=O)(=O)NCCc3ccc(Oc4ccccc4)cc3)cc2C1 |
| InChI | InChI=1S/C39H37N3O9S2/c43-36-34(23-35(37(44)38(36)45)53(49,50)42-21-18-27-6-4-5-7-29(27)25-42)39(46)41-20-17-28-12-15-33(22-30(28)24-41)52(47,48)40-19-16-26-10-13-32(14-11-26)51-31-8-2-1-3-9-31/h1-15,22-23,40,43-45H,16-21,24-25H2 |
| InChIKey | UUNYPWAXHYIPMH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 173.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|