C30H32N2O6S — CID 58626441
N-methyl-6-[methyl-(2,3,4-trihydroxy-5-propan-2-ylphenyl)sulfonylamino]-N-(2-phenylethyl)naphthalene-2-carboxamide (PubChem CID 58626441) has the molecular formula C30H32N2O6S and a molecular weight of 548.66 g/mol. Its IUPAC name is N-methyl-6-[methyl-(2,3,4-trihydroxy-5-propan-2-ylphenyl)sulfonylamino]-N-(2-phenylethyl)naphthalene-2-carboxamide.
| Compound Name | N-methyl-6-[methyl-(2,3,4-trihydroxy-5-propan-2-ylphenyl)sulfonylamino]-N-(2-phenylethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58626441 |
| Molecular Formula | C30H32N2O6S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | N-methyl-6-[methyl-(2,3,4-trihydroxy-5-propan-2-ylphenyl)sulfonylamino]-N-(2-phenylethyl)naphthalene-2-carboxamide |
| SMILES | CC(C)c1cc(S(=O)(=O)N(C)c2ccc3cc(C(=O)N(C)CCc4ccccc4)ccc3c2)c(O)c(O)c1O |
| InChI | InChI=1S/C30H32N2O6S/c1-19(2)25-18-26(28(34)29(35)27(25)33)39(37,38)32(4)24-13-12-21-16-23(11-10-22(21)17-24)30(36)31(3)15-14-20-8-6-5-7-9-20/h5-13,16-19,33-35H,14-15H2,1-4H3 |
| InChIKey | FVLWXPPDRHTHNJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|