About 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione
2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione (PubChem CID 58626859) has the molecular formula C23H13F6NO3
and a molecular weight of 465.35 g/mol. Its IUPAC name is 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione |
| PubChem CID | 58626859 |
| Molecular Formula | C23H13F6NO3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H13F6NO3/c24-22(25,26)14-9-15(23(27,28)29)11-17(10-14)33-16-7-5-13(6-8-16)12-30-20(31)18-3-1-2-4-19(18)21(30)32/h1-11H,12H2 |
| InChIKey | KCKJSUFTNKGOFJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione?
The IUPAC name of 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione (CID 58626859) is 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione?
The canonical SMILES for 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1Cc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione?
The InChIKey is KCKJSUFTNKGOFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13F6NO3/c24-22(25,26)14-9-15(23(27,28)29)11-17(10-14)33-16-7-5-13(6-8-16)12-30-20(31)18-3-1-2-4-19(18)21(30)32/h1-11H,12H2.
What are the key properties of 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione?
2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione has a molecular weight of 465.35 g/mol, XLogP of 6.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methyl]isoindole-1,3-dione is sourced from PubChem (CID 58626859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).