C31H32NOP — CID 58626935
[2-[(4S)-4-(1-adamantyl)-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 58626935) has the molecular formula C31H32NOP and a molecular weight of 465.58 g/mol. Its IUPAC name is [2-[(4S)-4-(1-adamantyl)-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4S)-4-(1-adamantyl)-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58626935 |
| Molecular Formula | C31H32NOP |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | [2-[(4S)-4-(1-adamantyl)-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2C2=N[C@@H](C34CC5CC(CC(C5)C3)C4)CO2)cc1 |
| InChI | InChI=1S/C31H32NOP/c1-3-9-25(10-4-1)34(26-11-5-2-6-12-26)28-14-8-7-13-27(28)30-32-29(21-33-30)31-18-22-15-23(19-31)17-24(16-22)20-31/h1-14,22-24,29H,15-21H2/t22?,23?,24?,29-,31?/m1/s1 |
| InChIKey | MEPKGLWQSSBJES-JVEIEMHESA-N |
| XLogP | 5.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|