C31H30NOP — CID 58626955
[2-[(4S,5S)-4-tert-butyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 58626955) has the molecular formula C31H30NOP and a molecular weight of 463.56 g/mol. Its IUPAC name is [2-[(4S,5S)-4-tert-butyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4S,5S)-4-tert-butyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58626955 |
| Molecular Formula | C31H30NOP |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [2-[(4S,5S)-4-tert-butyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@@H]1N=C(c2ccccc2P(c2ccccc2)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H30NOP/c1-31(2,3)29-28(23-15-7-4-8-16-23)33-30(32-29)26-21-13-14-22-27(26)34(24-17-9-5-10-18-24)25-19-11-6-12-20-25/h4-22,28-29H,1-3H3/t28-,29+/m0/s1 |
| InChIKey | QROWEAXXUPKJFE-URLMMPGGSA-N |
| XLogP | 6.38 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|