C33H44O4SSi — CID 58627434
tert-butyl-dimethyl-[[5-methyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane (PubChem CID 58627434) has the molecular formula C33H44O4SSi and a molecular weight of 564.86 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[5-methyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[5-methyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 58627434 |
| Molecular Formula | C33H44O4SSi |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | tert-butyl-dimethyl-[[5-methyl-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]silane |
| SMILES | CC1C(Sc2ccccc2)OC(CO[Si](C)(C)C(C)(C)C)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C33H44O4SSi/c1-25-30(34-22-26-16-10-7-11-17-26)31(35-23-27-18-12-8-13-19-27)29(24-36-39(5,6)33(2,3)4)37-32(25)38-28-20-14-9-15-21-28/h7-21,25,29-32H,22-24H2,1-6H3 |
| InChIKey | MGLZDRLGTJEGMR-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|