C26H19F2NO8 — CID 58627633
(4aR,5S,5aR,6Z,12aR)-6-[(3,5-difluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 58627633) has the molecular formula C26H19F2NO8 and a molecular weight of 511.43 g/mol. Its IUPAC name is (4aR,5S,5aR,6Z,12aR)-6-[(3,5-difluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6Z,12aR)-6-[(3,5-difluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627633 |
| Molecular Formula | C26H19F2NO8 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | (4aR,5S,5aR,6Z,12aR)-6-[(3,5-difluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4cc(F)cc(F)c4)[C@H]3[C@H](O)[C@H]2CC1=O |
| InChI | InChI=1S/C26H19F2NO8/c27-10-4-9(5-11(28)7-10)6-13-12-2-1-3-15(30)17(12)22(33)20-18(13)21(32)14-8-16(31)19(25(29)36)23(34)26(14,37)24(20)35/h1-7,14,18,21,30,32-34,37H,8H2,(H2,29,36)/b13-6+/t14-,18-,21-,26-/m1/s1 |
| InChIKey | GHNLXPDLYBYJPA-GFUQJCNSSA-N |
| XLogP | 1.67 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|