C30H23F6NO8 — CID 58627677
(4aR,5S,5aR,6R,12aR)-9-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627677) has the molecular formula C30H23F6NO8 and a molecular weight of 639.50 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aR)-9-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aR)-9-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627677 |
| Molecular Formula | C30H23F6NO8 |
| Molecular Weight | 639.50 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | (4aR,5S,5aR,6R,12aR)-9-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(/C=C/c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C30H23F6NO8/c1-10-15-5-4-12(3-2-11-6-13(29(31,32)33)8-14(7-11)30(34,35)36)22(39)19(15)24(41)21-18(10)23(40)16-9-17(38)20(27(37)44)25(42)28(16,45)26(21)43/h2-8,10,16,18,23,39-42,45H,9H2,1H3,(H2,37,44)/b3-2+/t10-,16+,18+,23+,28+/m0/s1 |
| InChIKey | YEBGOWKFHLHOAF-LTQUCJQQSA-N |
| XLogP | 4.16 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|