C21H20Cl2N4S2 — CID 58627870
N-[2-[4-[[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]amino]phenyl]ethyl]-5,6-dichloro-1,3-benzothiazol-2-amine (PubChem CID 58627870) has the molecular formula C21H20Cl2N4S2 and a molecular weight of 463.46 g/mol. Its IUPAC name is N-[2-[4-[[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]amino]phenyl]ethyl]-5,6-dichloro-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-[4-[[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]amino]phenyl]ethyl]-5,6-dichloro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 58627870 |
| Molecular Formula | C21H20Cl2N4S2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | N-[2-[4-[[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]amino]phenyl]ethyl]-5,6-dichloro-1,3-benzothiazol-2-amine |
| SMILES | Clc1cc2nc(NCCc3ccc(/N=C4\SC[C@@H]5CCCN45)cc3)sc2cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4S2/c22-16-10-18-19(11-17(16)23)29-20(26-18)24-8-7-13-3-5-14(6-4-13)25-21-27-9-1-2-15(27)12-28-21/h3-6,10-11,15H,1-2,7-9,12H2,(H,24,26)/b25-21-/t15-/m0/s1 |
| InChIKey | LZKWIPOWMKMIDX-RPKJYVOXSA-N |
| XLogP | 6.46 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|