About 2-propan-2-ylidene-1,3-thiazinane
2-propan-2-ylidene-1,3-thiazinane (PubChem CID 58627885) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 2-propan-2-ylidene-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-propan-2-ylidene-1,3-thiazinane |
| PubChem CID | 58627885 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2-propan-2-ylidene-1,3-thiazinane |
| SMILES | CC(C)=C1NCCCS1 |
| InChI | InChI=1S/C7H13NS/c1-6(2)7-8-4-3-5-9-7/h8H,3-5H2,1-2H3 |
| InChIKey | SUZFATQTHZYRRJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-ylidene-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylidene-1,3-thiazinane?
The IUPAC name of 2-propan-2-ylidene-1,3-thiazinane (CID 58627885) is 2-propan-2-ylidene-1,3-thiazinane.
What is the SMILES notation for 2-propan-2-ylidene-1,3-thiazinane?
The canonical SMILES for 2-propan-2-ylidene-1,3-thiazinane is CC(C)=C1NCCCS1.
What is the InChIKey of 2-propan-2-ylidene-1,3-thiazinane?
The InChIKey is SUZFATQTHZYRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-6(2)7-8-4-3-5-9-7/h8H,3-5H2,1-2H3.
What are the key properties of 2-propan-2-ylidene-1,3-thiazinane?
2-propan-2-ylidene-1,3-thiazinane has a molecular weight of 143.25 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylidene-1,3-thiazinane is sourced from PubChem (CID 58627885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).