About (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid
(2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid (PubChem CID 58628214) has the molecular formula C16H29NO4
and a molecular weight of 299.41 g/mol. Its IUPAC name is (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid.
Molecular Properties
| Compound Name | (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid |
| PubChem CID | 58628214 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid |
| SMILES | CC(C)CC(C)(C)C[C@H](CC(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C16H29NO4/c1-12(2)10-16(3,4)11-13(15(19)20)9-14(18)17-5-7-21-8-6-17/h12-13H,5-11H2,1-4H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | KVKWHYBTMDZIOS-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid?
The IUPAC name of (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid (CID 58628214) is (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid.
What is the SMILES notation for (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid?
The canonical SMILES for (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid is CC(C)CC(C)(C)C[C@H](CC(=O)N1CCOCC1)C(=O)O.
What is the InChIKey of (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid?
The InChIKey is KVKWHYBTMDZIOS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H29NO4/c1-12(2)10-16(3,4)11-13(15(19)20)9-14(18)17-5-7-21-8-6-17/h12-13H,5-11H2,1-4H3,(H,19,20)/t13-/m0/s1.
What are the key properties of (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid?
(2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid has a molecular weight of 299.41 g/mol, XLogP of 2.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4,6-trimethyl-2-(2-morpholin-4-yl-2-oxoethyl)heptanoic acid is sourced from PubChem (CID 58628214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).