C10H10F3NO — CID 58629584
7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-ol (PubChem CID 58629584) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-ol.
| Compound Name | 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 58629584 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinolin-5-ol |
| SMILES | Oc1cc(C(F)(F)F)cc2c1CCNC2 |
| InChI | InChI=1S/C10H10F3NO/c11-10(12,13)7-3-6-5-14-2-1-8(6)9(15)4-7/h3-4,14-15H,1-2,5H2 |
| InChIKey | JFXGANCSPWEDRH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |