C30H46OSi — CID 58630452
[1-[2-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane (PubChem CID 58630452) has the molecular formula C30H46OSi and a molecular weight of 450.78 g/mol. Its IUPAC name is [1-[2-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane.
| Compound Name | [1-[2-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 58630452 |
| Molecular Formula | C30H46OSi |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | [1-[2-(2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
| SMILES | C=CC[Si](OC1CC2C=CC=CC2C1CCC1C(C)CC2C=CC=CC21)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H46OSi/c1-7-18-32(21(2)3,22(4)5)31-30-20-25-13-9-11-15-28(25)29(30)17-16-26-23(6)19-24-12-8-10-14-27(24)26/h7-15,21-30H,1,16-20H2,2-6H3 |
| InChIKey | BVWLYEJGBFXHOE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|