C20H23ClN6O2 — CID 58630491
4-carbamimidoyl-N-[[(6S)-1-chloro-3-(cyclobutylamino)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazin-6-yl]methyl]benzamide (PubChem CID 58630491) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 4-carbamimidoyl-N-[[(6S)-1-chloro-3-(cyclobutylamino)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazin-6-yl]methyl]benzamide.
| Compound Name | 4-carbamimidoyl-N-[[(6S)-1-chloro-3-(cyclobutylamino)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazin-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58630491 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-carbamimidoyl-N-[[(6S)-1-chloro-3-(cyclobutylamino)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazin-6-yl]methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC[C@@H]2CCc3c(Cl)nc(NC4CCC4)c(=O)n32)cc1 |
| InChI | InChI=1S/C20H23ClN6O2/c21-16-15-9-8-14(27(15)20(29)18(26-16)25-13-2-1-3-13)10-24-19(28)12-6-4-11(5-7-12)17(22)23/h4-7,13-14H,1-3,8-10H2,(H3,22,23)(H,24,28)(H,25,26)/t14-/m0/s1 |
| InChIKey | CJYTVZVLDDCFGK-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|