About 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium
2,6-dimethyl-4H-pyrimidin-4-ide;vanadium (PubChem CID 58630510) has the molecular formula C6H7N2V-
and a molecular weight of 158.08 g/mol. Its IUPAC name is 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium.
Molecular Properties
| Compound Name | 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium |
|---|
| PubChem CID | 58630510 |
|---|
| Molecular Formula | C6H7N2V- |
|---|
| Molecular Weight | 158.08 g/mol |
|---|
| Exact Mass | 158.01 |
|---|
| IUPAC Name | 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium |
|---|
| SMILES | Cc1c[c-]nc(C)n1.[V] |
|---|
| InChI | InChI=1S/C6H7N2.V/c1-5-3-4-7-6(2)8-5;/h3H,1-2H3;/q-1; |
|---|
| InChIKey | RTGOIDSWWWTRKV-UHFFFAOYSA-N |
|---|
| XLogP | 0.89 |
|---|
| TPSA | 25.78 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 158.08 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium?
The IUPAC name of 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium (CID 58630510) is 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium.
What is the SMILES notation for 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium?
The canonical SMILES for 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium is Cc1c[c-]nc(C)n1.[V].
What is the InChIKey of 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium?
The InChIKey is RTGOIDSWWWTRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2.V/c1-5-3-4-7-6(2)8-5;/h3H,1-2H3;/q-1;.
What are the key properties of 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium?
2,6-dimethyl-4H-pyrimidin-4-ide;vanadium has a molecular weight of 158.08 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4H-pyrimidin-4-ide;vanadium is sourced from PubChem (CID 58630510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).