C5H5N2OV- — CID 58630511
2-methyl-1,4-dihydropyrimidin-4-id-6-one;vanadium (PubChem CID 58630511) has the molecular formula C5H5N2OV- and a molecular weight of 160.05 g/mol. Its IUPAC name is 2-methyl-1,4-dihydropyrimidin-4-id-6-one;vanadium.
| Compound Name | 2-methyl-1,4-dihydropyrimidin-4-id-6-one;vanadium |
|---|---|
| PubChem CID | 58630511 |
| Molecular Formula | C5H5N2OV- |
| Molecular Weight | 160.05 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 2-methyl-1,4-dihydropyrimidin-4-id-6-one;vanadium |
| SMILES | Cc1n[c-]cc(=O)[nH]1.[V] |
| InChI | InChI=1S/C5H5N2O.V/c1-4-6-3-2-5(8)7-4;/h2H,1H3,(H,6,7,8);/q-1; |
| InChIKey | IEZXYEFBVDFHPP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.05 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|