About (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene
(6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene (PubChem CID 58630601) has the molecular formula C11H22S
and a molecular weight of 186.36 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene.
Molecular Properties
| Compound Name | (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene |
| PubChem CID | 58630601 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene |
| SMILES | CSCC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C11H22S/c1-10(2)6-5-7-11(3)8-9-12-4/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | QMRWXZKMMMMLKJ-NSHDSACASA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene?
The IUPAC name of (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene (CID 58630601) is (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene.
What is the SMILES notation for (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene?
The canonical SMILES for (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene is CSCC[C@@H](C)CCC=C(C)C.
What is the InChIKey of (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene?
The InChIKey is QMRWXZKMMMMLKJ-NSHDSACASA-N. The full InChI is InChI=1S/C11H22S/c1-10(2)6-5-7-11(3)8-9-12-4/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1.
What are the key properties of (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene?
(6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene has a molecular weight of 186.36 g/mol, XLogP of 4.12, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,6-dimethyl-8-methylsulfanyloct-2-ene is sourced from PubChem (CID 58630601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).