About 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide
2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide (PubChem CID 58631053) has the molecular formula C16H16FN5O2
and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
| PubChem CID | 58631053 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
| SMILES | [N-]=[N+]=NCC(=O)N[C@H](CF)[C@H](O)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C16H16FN5O2/c17-8-14(21-15(23)10-20-22-18)16(24)12-5-3-11(4-6-12)13-2-1-7-19-9-13/h1-7,9,14,16,24H,8,10H2,(H,21,23)/t14-,16-/m1/s1 |
| InChIKey | AYRCKQVGBCLZAU-GDBMZVCRSA-N |
| XLogP | 2.55 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The IUPAC name of 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide (CID 58631053) is 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide.
What is the SMILES notation for 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The canonical SMILES for 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide is [N-]=[N+]=NCC(=O)N[C@H](CF)[C@H](O)c1ccc(-c2cccnc2)cc1.
What is the InChIKey of 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The InChIKey is AYRCKQVGBCLZAU-GDBMZVCRSA-N. The full InChI is InChI=1S/C16H16FN5O2/c17-8-14(21-15(23)10-20-22-18)16(24)12-5-3-11(4-6-12)13-2-1-7-19-9-13/h1-7,9,14,16,24H,8,10H2,(H,21,23)/t14-,16-/m1/s1.
What are the key properties of 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide has a molecular weight of 329.34 g/mol, XLogP of 2.55, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide is sourced from PubChem (CID 58631053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).