C17H18F3N2O3+ — CID 58631061
2,2-difluoro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1-methoxypyridin-1-ium-4-yl)phenyl]propan-2-yl]acetamide (PubChem CID 58631061) has the molecular formula C17H18F3N2O3+ and a molecular weight of 355.34 g/mol. Its IUPAC name is 2,2-difluoro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1-methoxypyridin-1-ium-4-yl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-difluoro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1-methoxypyridin-1-ium-4-yl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 58631061 |
| Molecular Formula | C17H18F3N2O3+ |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2,2-difluoro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(1-methoxypyridin-1-ium-4-yl)phenyl]propan-2-yl]acetamide |
| SMILES | CO[n+]1ccc(-c2ccc([C@@H](O)[C@@H](CF)NC(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F3N2O3/c1-25-22-8-6-12(7-9-22)11-2-4-13(5-3-11)15(23)14(10-18)21-17(24)16(19)20/h2-9,14-16,23H,10H2,1H3/p+1/t14-,15-/m1/s1 |
| InChIKey | QJGJMNVGZCQHOU-HUUCEWRRSA-O |
| XLogP | 1.45 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|