C19H18Cl2FNO3 — CID 58631081
N-[(1R,2S)-1-[4-(4-acetylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 58631081) has the molecular formula C19H18Cl2FNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is N-[(1R,2S)-1-[4-(4-acetylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[(1R,2S)-1-[4-(4-acetylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 58631081 |
| Molecular Formula | C19H18Cl2FNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-[(1R,2S)-1-[4-(4-acetylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | CC(=O)c1ccc(-c2ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18Cl2FNO3/c1-11(24)12-2-4-13(5-3-12)14-6-8-15(9-7-14)17(25)16(10-22)23-19(26)18(20)21/h2-9,16-18,25H,10H2,1H3,(H,23,26)/t16-,17-/m1/s1 |
| InChIKey | RUDXKBIZTNGMJT-IAGOWNOFSA-N |
| XLogP | 3.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|