C12H12Cl2FNO4 — CID 58631113
4-[(1R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoic acid (PubChem CID 58631113) has the molecular formula C12H12Cl2FNO4 and a molecular weight of 324.14 g/mol. Its IUPAC name is 4-[(1R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoic acid.
| Compound Name | 4-[(1R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoic acid |
|---|---|
| PubChem CID | 58631113 |
| Molecular Formula | C12H12Cl2FNO4 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[(1R)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoic acid |
| SMILES | O=C(O)c1ccc([C@@H](O)C(CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2FNO4/c13-10(14)11(18)16-8(5-15)9(17)6-1-3-7(4-2-6)12(19)20/h1-4,8-10,17H,5H2,(H,16,18)(H,19,20)/t8?,9-/m1/s1 |
| InChIKey | KFEFDJSHMVMOIQ-YGPZHTELSA-N |
| XLogP | 1.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|