C14H14Cl2FN3O2S — CID 58631130
N-[(1R,2S)-1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 58631130) has the molecular formula C14H14Cl2FN3O2S and a molecular weight of 378.26 g/mol. Its IUPAC name is N-[(1R,2S)-1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[(1R,2S)-1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 58631130 |
| Molecular Formula | C14H14Cl2FN3O2S |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[(1R,2S)-1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | Nc1ncc(-c2ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc2)s1 |
| InChI | InChI=1S/C14H14Cl2FN3O2S/c15-12(16)13(22)20-9(5-17)11(21)8-3-1-7(2-4-8)10-6-19-14(18)23-10/h1-4,6,9,11-12,21H,5H2,(H2,18,19)(H,20,22)/t9-,11-/m1/s1 |
| InChIKey | XPTKUVUQJWKKBZ-MWLCHTKSSA-N |
| XLogP | 2.68 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|