C22H32FNO3Si — CID 58631179
tert-butyl (4S,5R)-4-(fluoromethyl)-2,2-dimethyl-5-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 58631179) has the molecular formula C22H32FNO3Si and a molecular weight of 405.59 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(fluoromethyl)-2,2-dimethyl-5-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(fluoromethyl)-2,2-dimethyl-5-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58631179 |
| Molecular Formula | C22H32FNO3Si |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl (4S,5R)-4-(fluoromethyl)-2,2-dimethyl-5-[4-(2-trimethylsilylethynyl)phenyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CF)[C@@H](c2ccc(C#C[Si](C)(C)C)cc2)OC1(C)C |
| InChI | InChI=1S/C22H32FNO3Si/c1-21(2,3)27-20(25)24-18(15-23)19(26-22(24,4)5)17-11-9-16(10-12-17)13-14-28(6,7)8/h9-12,18-19H,15H2,1-8H3/t18-,19-/m1/s1 |
| InChIKey | NPRCBYUUOBTBRE-RTBURBONSA-N |
| XLogP | 5.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|