About 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide
2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide (PubChem CID 58631180) has the molecular formula C17H16FN3O2
and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
| PubChem CID | 58631180 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide |
| SMILES | N#CCC(=O)N[C@H](CF)[C@H](O)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C17H16FN3O2/c18-10-15(21-16(22)7-8-19)17(23)13-5-3-12(4-6-13)14-2-1-9-20-11-14/h1-6,9,11,15,17,23H,7,10H2,(H,21,22)/t15-,17-/m1/s1 |
| InChIKey | PXSXKSXCJJIGFW-NVXWUHKLSA-N |
| XLogP | 2.15 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The IUPAC name of 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide (CID 58631180) is 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide.
What is the SMILES notation for 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The canonical SMILES for 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide is N#CCC(=O)N[C@H](CF)[C@H](O)c1ccc(-c2cccnc2)cc1.
What is the InChIKey of 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
The InChIKey is PXSXKSXCJJIGFW-NVXWUHKLSA-N. The full InChI is InChI=1S/C17H16FN3O2/c18-10-15(21-16(22)7-8-19)17(23)13-5-3-12(4-6-13)14-2-1-9-20-11-14/h1-6,9,11,15,17,23H,7,10H2,(H,21,22)/t15-,17-/m1/s1.
What are the key properties of 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide?
2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide has a molecular weight of 313.33 g/mol, XLogP of 2.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-pyridin-3-ylphenyl)propan-2-yl]acetamide is sourced from PubChem (CID 58631180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).