C26H22BrNO4 — CID 58631586
(Z)-3-[4-(2-bromophenoxy)phenyl]-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)prop-2-enoic acid (PubChem CID 58631586) has the molecular formula C26H22BrNO4 and a molecular weight of 492.37 g/mol. Its IUPAC name is (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 58631586 |
| Molecular Formula | C26H22BrNO4 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | (Z)-3-[4-(2-bromophenoxy)phenyl]-2-(1,2,3,4-tetrahydronaphthalene-2-carbonylamino)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc(Oc2ccccc2Br)cc1)NC(=O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H22BrNO4/c27-22-7-3-4-8-24(22)32-21-13-9-17(10-14-21)15-23(26(30)31)28-25(29)20-12-11-18-5-1-2-6-19(18)16-20/h1-10,13-15,20H,11-12,16H2,(H,28,29)(H,30,31)/b23-15- |
| InChIKey | COLUEDHKYRBVPF-HAHDFKILSA-N |
| XLogP | 5.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|