C21H14F3NO3S — CID 58631824
(Z)-2-benzamido-3-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 58631824) has the molecular formula C21H14F3NO3S and a molecular weight of 417.41 g/mol. Its IUPAC name is (Z)-2-benzamido-3-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-benzamido-3-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58631824 |
| Molecular Formula | C21H14F3NO3S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (Z)-2-benzamido-3-[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cc(-c2ccccc2)c(C(F)(F)F)s1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H14F3NO3S/c22-21(23,24)18-16(13-7-3-1-4-8-13)11-15(29-18)12-17(20(27)28)25-19(26)14-9-5-2-6-10-14/h1-12H,(H,25,26)(H,27,28)/b17-12- |
| InChIKey | IVXSBJAKDHWUJG-ATVHPVEESA-N |
| XLogP | 5.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|