C6H11F3N2SiY2-2 — CID 58632353
2-(4,4,4-trifluorobutyl)-1,3-diazanida-2-silacyclopentane;bis(yttrium) (PubChem CID 58632353) has the molecular formula C6H11F3N2SiY2-2 and a molecular weight of 374.06 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutyl)-1,3-diazanida-2-silacyclopentane;bis(yttrium).
| Compound Name | 2-(4,4,4-trifluorobutyl)-1,3-diazanida-2-silacyclopentane;bis(yttrium) |
|---|---|
| PubChem CID | 58632353 |
| Molecular Formula | C6H11F3N2SiY2-2 |
| Molecular Weight | 374.06 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 2-(4,4,4-trifluorobutyl)-1,3-diazanida-2-silacyclopentane;bis(yttrium) |
| SMILES | FC(F)(F)CCC[SiH]1[N-]CC[N-]1.[Y].[Y] |
| InChI | InChI=1S/C6H11F3N2Si.2Y/c7-6(8,9)2-1-5-12-10-3-4-11-12;;/h12H,1-5H2;;/q-2;; |
| InChIKey | GLIGXPYAAVSFNO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.06 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|