C10H18O8 — CID 58633227
(1S,3R,4R,5R)-1,3,4-trihydroxy-5-(1,2,3-trihydroxypropyl)cyclohexane-1-carboxylic acid (PubChem CID 58633227) has the molecular formula C10H18O8 and a molecular weight of 266.25 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,3,4-trihydroxy-5-(1,2,3-trihydroxypropyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-(1,2,3-trihydroxypropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58633227 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-(1,2,3-trihydroxypropyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@H](C(O)C(O)CO)C1 |
| InChI | InChI=1S/C10H18O8/c11-3-6(13)8(15)4-1-10(18,9(16)17)2-5(12)7(4)14/h4-8,11-15,18H,1-3H2,(H,16,17)/t4-,5-,6?,7-,8?,10+/m1/s1 |
| InChIKey | REDQFYIJXMVGRC-OOBAKZDLSA-N |
| XLogP | -3.35 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |