C18H28O9 — CID 58633645
ethyl 3-methyl-4-[(2S,3S,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]butanoate (PubChem CID 58633645) has the molecular formula C18H28O9 and a molecular weight of 388.41 g/mol. Its IUPAC name is ethyl 3-methyl-4-[(2S,3S,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]butanoate.
| Compound Name | ethyl 3-methyl-4-[(2S,3S,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]butanoate |
|---|---|
| PubChem CID | 58633645 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 3-methyl-4-[(2S,3S,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]butanoate |
| SMILES | CCOC(=O)CC(C)C[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H28O9/c1-6-23-16(22)8-10(2)7-14-17(26-12(4)20)18(27-13(5)21)15(9-24-14)25-11(3)19/h10,14-15,17-18H,6-9H2,1-5H3/t10?,14-,15+,17-,18-/m0/s1 |
| InChIKey | RZKPPPCGVCZGTN-WMAHHUAZSA-N |
| XLogP | 1.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|