C21H29NO7 — CID 58633650
[(3R,4S,5S,6S)-4,5-diacetyloxy-6-[2-(benzylamino)propyl]oxan-3-yl] acetate (PubChem CID 58633650) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[2-(benzylamino)propyl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[2-(benzylamino)propyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 58633650 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[2-(benzylamino)propyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1CC(C)NCc1ccccc1 |
| InChI | InChI=1S/C21H29NO7/c1-13(22-11-17-8-6-5-7-9-17)10-18-20(28-15(3)24)21(29-16(4)25)19(12-26-18)27-14(2)23/h5-9,13,18-22H,10-12H2,1-4H3/t13?,18-,19+,20-,21-/m0/s1 |
| InChIKey | DUTSWYFYTDQYNG-LANAIQQUSA-N |
| XLogP | 1.75 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|