C27H27F6N3O3 — CID 58633750
(5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-3-prop-2-enyl-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 58633750) has the molecular formula C27H27F6N3O3 and a molecular weight of 555.52 g/mol. Its IUPAC name is (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-3-prop-2-enyl-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-3-prop-2-enyl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 58633750 |
| Molecular Formula | C27H27F6N3O3 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (5R,8S)-8-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-3-prop-2-enyl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C=CCN1C(=O)N[C@@]2(CC[C@@](CO[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(c3ccccc3)NC2)C1=O |
| InChI | InChI=1S/C27H27F6N3O3/c1-3-11-36-22(37)24(35-23(36)38)9-10-25(34-15-24,19-7-5-4-6-8-19)16-39-17(2)18-12-20(26(28,29)30)14-21(13-18)27(31,32)33/h3-8,12-14,17,34H,1,9-11,15-16H2,2H3,(H,35,38)/t17-,24-,25-/m1/s1 |
| InChIKey | BOMQCWANAYLEDI-LJXNEXSDSA-N |
| XLogP | 5.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|