C19H23F6NO — CID 58633818
(2R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1,2-dimethyl-5-methylidenepiperidine (PubChem CID 58633818) has the molecular formula C19H23F6NO and a molecular weight of 395.39 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1,2-dimethyl-5-methylidenepiperidine.
| Compound Name | (2R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1,2-dimethyl-5-methylidenepiperidine |
|---|---|
| PubChem CID | 58633818 |
| Molecular Formula | C19H23F6NO |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (2R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1,2-dimethyl-5-methylidenepiperidine |
| SMILES | C=C1CC[C@](C)(CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N(C)C1 |
| InChI | InChI=1S/C19H23F6NO/c1-12-5-6-17(3,26(4)10-12)11-27-13(2)14-7-15(18(20,21)22)9-16(8-14)19(23,24)25/h7-9,13H,1,5-6,10-11H2,2-4H3/t13-,17-/m1/s1 |
| InChIKey | HMZKINCJURLUEZ-CXAGYDPISA-N |
| XLogP | 5.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|