C21H31N3Si — CID 58634095
dimethyl-(2-methyl-4-pyridin-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane (PubChem CID 58634095) has the molecular formula C21H31N3Si and a molecular weight of 353.59 g/mol. Its IUPAC name is dimethyl-(2-methyl-4-pyridin-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane.
| Compound Name | dimethyl-(2-methyl-4-pyridin-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane |
|---|---|
| PubChem CID | 58634095 |
| Molecular Formula | C21H31N3Si |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | dimethyl-(2-methyl-4-pyridin-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane |
| SMILES | CC1CC2C(c3ccccn3)=CC=CC2C1[Si](C)(C)N1CCNCC1 |
| InChI | InChI=1S/C21H31N3Si/c1-16-15-19-17(20-9-4-5-10-23-20)7-6-8-18(19)21(16)25(2,3)24-13-11-22-12-14-24/h4-10,16,18-19,21-22H,11-15H2,1-3H3 |
| InChIKey | MFXVHYYLRBRNFI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|