C26H33Cl2N3SiTi-2 — CID 58634175
(1S,3aS,7aR)-3-[dimethyl(phenazin-10-id-5-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine;carbanide;dichlorotitanium (PubChem CID 58634175) has the molecular formula C26H33Cl2N3SiTi-2 and a molecular weight of 534.43 g/mol. Its IUPAC name is (1S,3aS,7aR)-3-[dimethyl(phenazin-10-id-5-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine;carbanide;dichlorotitanium.
| Compound Name | (1S,3aS,7aR)-3-[dimethyl(phenazin-10-id-5-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634175 |
| Molecular Formula | C26H33Cl2N3SiTi-2 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | (1S,3aS,7aR)-3-[dimethyl(phenazin-10-id-5-yl)silyl]-N,N-dimethyl-2,3,3a,7a-tetrahydro-1H-inden-1-amine;carbanide;dichlorotitanium |
| SMILES | CN(C)[C@H]1CC([Si](C)(C)N2c3ccccc3[N-]c3ccccc32)[C@H]2C=CC=C[C@H]21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C25H30N3Si.CH3.2ClH.Ti/c1-27(2)24-17-25(19-12-6-5-11-18(19)24)29(3,4)28-22-15-9-7-13-20(22)26-21-14-8-10-16-23(21)28;;;;/h5-16,18-19,24-25H,17H2,1-4H3;1H3;2*1H;/q2*-1;;;+2/p-2/t18-,19+,24+,25?;;;;/m1..../s1 |
| InChIKey | HTMCHLQVSDQHEU-JDOHJGQVSA-L |
| XLogP | 8.57 |
| TPSA | 20.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|