C26H40Cl2N2SiTi-2 — CID 58634465
[4-(4-tert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-piperazin-4-id-1-ylsilane;carbanide;dichlorotitanium (PubChem CID 58634465) has the molecular formula C26H40Cl2N2SiTi-2 and a molecular weight of 527.48 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-piperazin-4-id-1-ylsilane;carbanide;dichlorotitanium.
| Compound Name | [4-(4-tert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-piperazin-4-id-1-ylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634465 |
| Molecular Formula | C26H40Cl2N2SiTi-2 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | [4-(4-tert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-piperazin-4-id-1-ylsilane;carbanide;dichlorotitanium |
| SMILES | CC(C)(C)c1ccc(C2=CC=CC3C2CCC3[Si](C)(C)N2CC[N-]CC2)cc1.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C25H37N2Si.CH3.2ClH.Ti/c1-25(2,3)20-11-9-19(10-12-20)21-7-6-8-23-22(21)13-14-24(23)28(4,5)27-17-15-26-16-18-27;;;;/h6-12,22-24H,13-18H2,1-5H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | DRYSYIUMUGNEFT-UHFFFAOYSA-L |
| XLogP | 8.05 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|