C21H39N3Si — CID 58634527
dimethyl-[2-methyl-4,6-di(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(1,3,5-triazinan-1-yl)silane (PubChem CID 58634527) has the molecular formula C21H39N3Si and a molecular weight of 361.65 g/mol. Its IUPAC name is dimethyl-[2-methyl-4,6-di(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(1,3,5-triazinan-1-yl)silane.
| Compound Name | dimethyl-[2-methyl-4,6-di(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(1,3,5-triazinan-1-yl)silane |
|---|---|
| PubChem CID | 58634527 |
| Molecular Formula | C21H39N3Si |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 361.29 |
| IUPAC Name | dimethyl-[2-methyl-4,6-di(propan-2-yl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-(1,3,5-triazinan-1-yl)silane |
| SMILES | CC(C)C1=CC2C(CC(C)C2[Si](C)(C)N2CNCNC2)C(C(C)C)=C1 |
| InChI | InChI=1S/C21H39N3Si/c1-14(2)17-9-18(15(3)4)19-8-16(5)21(20(19)10-17)25(6,7)24-12-22-11-23-13-24/h9-10,14-16,19-23H,8,11-13H2,1-7H3 |
| InChIKey | LASOQXTUSNFUKJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|