C29H36Cl2N2SiTi-2 — CID 58634627
[(2S,3aR)-2-ethyl-3a,9a-dihydro-2H-benzo[f]benzimidazol-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium (PubChem CID 58634627) has the molecular formula C29H36Cl2N2SiTi-2 and a molecular weight of 559.48 g/mol. Its IUPAC name is [(2S,3aR)-2-ethyl-3a,9a-dihydro-2H-benzo[f]benzimidazol-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium.
| Compound Name | [(2S,3aR)-2-ethyl-3a,9a-dihydro-2H-benzo[f]benzimidazol-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634627 |
| Molecular Formula | C29H36Cl2N2SiTi-2 |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | [(2S,3aR)-2-ethyl-3a,9a-dihydro-2H-benzo[f]benzimidazol-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
| SMILES | CC[C@H]1[N-]C2C=c3ccccc3=C[C@H]2N1[Si](C)(C)C1C2C=CC=CC2C2C=CC=CC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C28H33N2Si.CH3.2ClH.Ti/c1-4-27-29-25-17-19-11-5-6-12-20(19)18-26(25)30(27)31(2,3)28-23-15-9-7-13-21(23)22-14-8-10-16-24(22)28;;;;/h5-18,21-28H,4H2,1-3H3;1H3;2*1H;/q2*-1;;;+2/p-2/t21?,22?,23?,24?,25?,26-,27+,28?;;;;/m1..../s1 |
| InChIKey | YLLDQOPMGOBYJF-WFOZKBRPSA-L |
| XLogP | 6.56 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|